C27H19N3O3S — CID 4298735
2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N-(2-oxochromen-6-yl)acetamide (PubChem CID 4298735) has the molecular formula C27H19N3O3S and a molecular weight of 465.53 g/mol. Its IUPAC name is 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N-(2-oxochromen-6-yl)acetamide.
| Compound Name | 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N-(2-oxochromen-6-yl)acetamide |
|---|---|
| PubChem CID | 4298735 |
| Molecular Formula | C27H19N3O3S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 2-(4,6-diphenylpyrimidin-2-yl)sulfanyl-N-(2-oxochromen-6-yl)acetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)cc(-c2ccccc2)n1)Nc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C27H19N3O3S/c31-25(28-21-12-13-24-20(15-21)11-14-26(32)33-24)17-34-27-29-22(18-7-3-1-4-8-18)16-23(30-27)19-9-5-2-6-10-19/h1-16H,17H2,(H,28,31) |
| InChIKey | QKKKCCSPLXPGFM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|