C20H15N3O5S — CID 4026797
2-[[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-oxochromen-6-yl)acetamide (PubChem CID 4026797) has the molecular formula C20H15N3O5S and a molecular weight of 409.42 g/mol. Its IUPAC name is 2-[[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-oxochromen-6-yl)acetamide.
| Compound Name | 2-[[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-oxochromen-6-yl)acetamide |
|---|---|
| PubChem CID | 4026797 |
| Molecular Formula | C20H15N3O5S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 2-[[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-oxochromen-6-yl)acetamide |
| SMILES | COc1cccc(-c2nnc(SCC(=O)Nc3ccc4oc(=O)ccc4c3)o2)c1 |
| InChI | InChI=1S/C20H15N3O5S/c1-26-15-4-2-3-13(10-15)19-22-23-20(28-19)29-11-17(24)21-14-6-7-16-12(9-14)5-8-18(25)27-16/h2-10H,11H2,1H3,(H,21,24) |
| InChIKey | QHQNCCCCOPZBTB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|