C23H15N3O4S — CID 3668874
2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-oxochromen-6-yl)acetamide (PubChem CID 3668874) has the molecular formula C23H15N3O4S and a molecular weight of 429.46 g/mol. Its IUPAC name is 2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-oxochromen-6-yl)acetamide.
| Compound Name | 2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-oxochromen-6-yl)acetamide |
|---|---|
| PubChem CID | 3668874 |
| Molecular Formula | C23H15N3O4S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-(2-oxochromen-6-yl)acetamide |
| SMILES | O=C(CSc1nnc(-c2cccc3ccccc23)o1)Nc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C23H15N3O4S/c27-20(24-16-9-10-19-15(12-16)8-11-21(28)29-19)13-31-23-26-25-22(30-23)18-7-3-5-14-4-1-2-6-17(14)18/h1-12H,13H2,(H,24,27) |
| InChIKey | USFBGSUDUVGQMA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|