C23H14N2O4S — CID 4668510
3-[2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]chromen-2-one (PubChem CID 4668510) has the molecular formula C23H14N2O4S and a molecular weight of 414.44 g/mol. Its IUPAC name is 3-[2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]chromen-2-one.
| Compound Name | 3-[2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]chromen-2-one |
|---|---|
| PubChem CID | 4668510 |
| Molecular Formula | C23H14N2O4S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 3-[2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]chromen-2-one |
| SMILES | O=C(CSc1nnc(-c2cccc3ccccc23)o1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C23H14N2O4S/c26-19(18-12-15-7-2-4-11-20(15)28-22(18)27)13-30-23-25-24-21(29-23)17-10-5-8-14-6-1-3-9-16(14)17/h1-12H,13H2 |
| InChIKey | YZIMVUXVABSHIT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|