C13H9N3O3S — CID 9457523
3-[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]chromen-2-one (PubChem CID 9457523) has the molecular formula C13H9N3O3S and a molecular weight of 287.30 g/mol. Its IUPAC name is 3-[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]chromen-2-one.
| Compound Name | 3-[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]chromen-2-one |
|---|---|
| PubChem CID | 9457523 |
| Molecular Formula | C13H9N3O3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 3-[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]chromen-2-one |
| SMILES | O=C(CSc1ncn[nH]1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C13H9N3O3S/c17-10(6-20-13-14-7-15-16-13)9-5-8-3-1-2-4-11(8)19-12(9)18/h1-5,7H,6H2,(H,14,15,16) |
| InChIKey | QACQGECPBXWMFX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|