C14H10N2O4S — CID 3929242
3-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]chromen-2-one (PubChem CID 3929242) has the molecular formula C14H10N2O4S and a molecular weight of 302.31 g/mol. Its IUPAC name is 3-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]chromen-2-one.
| Compound Name | 3-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]chromen-2-one |
|---|---|
| PubChem CID | 3929242 |
| Molecular Formula | C14H10N2O4S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 3-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]chromen-2-one |
| SMILES | Cc1nnc(SCC(=O)c2cc3ccccc3oc2=O)o1 |
| InChI | InChI=1S/C14H10N2O4S/c1-8-15-16-14(19-8)21-7-11(17)10-6-9-4-2-3-5-12(9)20-13(10)18/h2-6H,7H2,1H3 |
| InChIKey | JEYLIHWYNHDIGZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|