C20H13N3O2S — CID 91683582
[2-[(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)amino]-2-oxoethyl] thiocyanate (PubChem CID 91683582) has the molecular formula C20H13N3O2S and a molecular weight of 359.41 g/mol. Its IUPAC name is [2-[(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)amino]-2-oxoethyl] thiocyanate.
| Compound Name | [2-[(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)amino]-2-oxoethyl] thiocyanate |
|---|---|
| PubChem CID | 91683582 |
| Molecular Formula | C20H13N3O2S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | [2-[(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)amino]-2-oxoethyl] thiocyanate |
| SMILES | N#CSCC(=O)Nc1ccc2oc(-c3cccc4ccccc34)nc2c1 |
| InChI | InChI=1S/C20H13N3O2S/c21-12-26-11-19(24)22-14-8-9-18-17(10-14)23-20(25-18)16-7-3-5-13-4-1-2-6-15(13)16/h1-10H,11H2,(H,22,24) |
| InChIKey | XKDXBWBHFFSBBV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|