C22H13BrN2O3 — CID 1142575
5-bromo-N-(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)furan-2-carboxamide (PubChem CID 1142575) has the molecular formula C22H13BrN2O3 and a molecular weight of 433.26 g/mol. Its IUPAC name is 5-bromo-N-(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1142575 |
| Molecular Formula | C22H13BrN2O3 |
| Molecular Weight | 433.26 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 5-bromo-N-(2-naphthalen-1-yl-1,3-benzoxazol-5-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2oc(-c3cccc4ccccc34)nc2c1)c1ccc(Br)o1 |
| InChI | InChI=1S/C22H13BrN2O3/c23-20-11-10-19(27-20)21(26)24-14-8-9-18-17(12-14)25-22(28-18)16-7-3-5-13-4-1-2-6-15(13)16/h1-12H,(H,24,26) |
| InChIKey | CXUVEXVCUWHDPE-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.26 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |