C23H20N4OS2 — CID 176510139
N-[2-(2-methylanilino)-5-(methylcarbamothioyl)-3-pyridinyl]-1-benzothiophene-3-carboxamide (PubChem CID 176510139) has the molecular formula C23H20N4OS2 and a molecular weight of 432.57 g/mol. Its IUPAC name is N-[2-(2-methylanilino)-5-(methylcarbamothioyl)-3-pyridinyl]-1-benzothiophene-3-carboxamide.
| Compound Name | N-[2-(2-methylanilino)-5-(methylcarbamothioyl)-3-pyridinyl]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 176510139 |
| Molecular Formula | C23H20N4OS2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | N-[2-(2-methylanilino)-5-(methylcarbamothioyl)-3-pyridinyl]-1-benzothiophene-3-carboxamide |
| SMILES | CNC(=S)c1cnc(Nc2ccccc2C)c(NC(=O)c2csc3ccccc23)c1 |
| InChI | InChI=1S/C23H20N4OS2/c1-14-7-3-5-9-18(14)26-21-19(11-15(12-25-21)23(29)24-2)27-22(28)17-13-30-20-10-6-4-8-16(17)20/h3-13H,1-2H3,(H,24,29)(H,25,26)(H,27,28) |
| InChIKey | MJUMILUEGCUYIT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|