C35H29ClF2N6O8S — CID 176514021
N-[(1S)-1-[7-chloro-3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]-2-(3,5-difluorophenyl)ethyl]-2-[4-(4-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]acetamide (PubChem CID 176514021) has the molecular formula C35H29ClF2N6O8S and a molecular weight of 767.17 g/mol. Its IUPAC name is N-[(1S)-1-[7-chloro-3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]-2-(3,5-difluorophenyl)ethyl]-2-[4-(4-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]acetamide.
| Compound Name | N-[(1S)-1-[7-chloro-3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]-2-(3,5-difluorophenyl)ethyl]-2-[4-(4-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 176514021 |
| Molecular Formula | C35H29ClF2N6O8S |
| Molecular Weight | 767.17 g/mol |
| Exact Mass | 766.14 |
| IUPAC Name | N-[(1S)-1-[7-chloro-3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]-2-(3,5-difluorophenyl)ethyl]-2-[4-(4-nitrophenyl)sulfonyl-2-oxopiperazin-1-yl]acetamide |
| SMILES | COc1ccc(-n2c([C@H](Cc3cc(F)cc(F)c3)NC(=O)CN3CCN(S(=O)(=O)c4ccc([N+](=O)[O-])cc4)CC3=O)nc3cc(Cl)ccc3c2=O)cc1 |
| InChI | InChI=1S/C35H29ClF2N6O8S/c1-52-27-7-3-25(4-8-27)43-34(40-30-17-22(36)2-11-29(30)35(43)47)31(16-21-14-23(37)18-24(38)15-21)39-32(45)19-41-12-13-42(20-33(41)46)53(50,51)28-9-5-26(6-10-28)44(48)49/h2-11,14-15,17-18,31H,12-13,16,19-20H2,1H3,(H,39,45)/t31-/m0/s1 |
| InChIKey | SXTQQNKZLJOIRZ-HKBQPEDESA-N |
| XLogP | 4.17 |
| TPSA | 174.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.17 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|