C16H14F2O2 — CID 176514272
2-[3-(2,5-difluorophenyl)phenyl]-2-methylpropanoic acid (PubChem CID 176514272) has the molecular formula C16H14F2O2 and a molecular weight of 276.28 g/mol. Its IUPAC name is 2-[3-(2,5-difluorophenyl)phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[3-(2,5-difluorophenyl)phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 176514272 |
| Molecular Formula | C16H14F2O2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-[3-(2,5-difluorophenyl)phenyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1cccc(-c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C16H14F2O2/c1-16(2,15(19)20)11-5-3-4-10(8-11)13-9-12(17)6-7-14(13)18/h3-9H,1-2H3,(H,19,20) |
| InChIKey | ZHHSQVKNNJZEFA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |