C28H43NO6 — CID 176515042
[(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 6-(dimethylamino)hexanoate (PubChem CID 176515042) has the molecular formula C28H43NO6 and a molecular weight of 489.65 g/mol. Its IUPAC name is [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 6-(dimethylamino)hexanoate.
| Compound Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 6-(dimethylamino)hexanoate |
|---|---|
| PubChem CID | 176515042 |
| Molecular Formula | C28H43NO6 |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 6-(dimethylamino)hexanoate |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)CCCCCN(C)C)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C28H43NO6/c1-16-14-27-17(2)12-20-22(26(20,3)4)19(24(27)33)13-18(15-30)23(32)28(27,34)25(16)35-21(31)10-8-7-9-11-29(5)6/h13-14,17,19-20,22-23,25,30,32,34H,7-12,15H2,1-6H3/t17-,19+,20-,22+,23-,25+,27+,28+/m1/s1 |
| InChIKey | GUBOIWUQCLYUMB-GFOGTWSLSA-N |
| XLogP | 2.49 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|