C16H17F4NO — CID 176515222
2-(3-ethenyl-5-fluorophenyl)-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone (PubChem CID 176515222) has the molecular formula C16H17F4NO and a molecular weight of 315.31 g/mol. Its IUPAC name is 2-(3-ethenyl-5-fluorophenyl)-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(3-ethenyl-5-fluorophenyl)-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 176515222 |
| Molecular Formula | C16H17F4NO |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-(3-ethenyl-5-fluorophenyl)-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone |
| SMILES | C=Cc1cc(F)cc(CC(=O)N2CCCC(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C16H17F4NO/c1-2-11-6-12(8-14(17)7-11)9-15(22)21-5-3-4-13(10-21)16(18,19)20/h2,6-8,13H,1,3-5,9-10H2 |
| InChIKey | DWDLOGRTDWBWOD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |