C17H20F3NO2 — CID 176516168
2-(3-ethenyl-4-methoxyphenyl)-1-[2-(trifluoromethyl)piperidin-1-yl]ethanone (PubChem CID 176516168) has the molecular formula C17H20F3NO2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 2-(3-ethenyl-4-methoxyphenyl)-1-[2-(trifluoromethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(3-ethenyl-4-methoxyphenyl)-1-[2-(trifluoromethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 176516168 |
| Molecular Formula | C17H20F3NO2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-(3-ethenyl-4-methoxyphenyl)-1-[2-(trifluoromethyl)piperidin-1-yl]ethanone |
| SMILES | C=Cc1cc(CC(=O)N2CCCCC2C(F)(F)F)ccc1OC |
| InChI | InChI=1S/C17H20F3NO2/c1-3-13-10-12(7-8-14(13)23-2)11-16(22)21-9-5-4-6-15(21)17(18,19)20/h3,7-8,10,15H,1,4-6,9,11H2,2H3 |
| InChIKey | FYDZFMVBOZSUHF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |