C12H14F3NOS — CID 91815998
2-thiophen-2-yl-1-[2-(trifluoromethyl)piperidin-1-yl]ethanone (PubChem CID 91815998) has the molecular formula C12H14F3NOS and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-thiophen-2-yl-1-[2-(trifluoromethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-thiophen-2-yl-1-[2-(trifluoromethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 91815998 |
| Molecular Formula | C12H14F3NOS |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-thiophen-2-yl-1-[2-(trifluoromethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(Cc1cccs1)N1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C12H14F3NOS/c13-12(14,15)10-5-1-2-6-16(10)11(17)8-9-4-3-7-18-9/h3-4,7,10H,1-2,5-6,8H2 |
| InChIKey | XFJMDYQKVQEQFT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |