C13H24N4 — CID 176516725
N-[2-(7-iminoazepan-2-yl)ethyl]-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 176516725) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is N-[2-(7-iminoazepan-2-yl)ethyl]-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | N-[2-(7-iminoazepan-2-yl)ethyl]-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 176516725 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | N-[2-(7-iminoazepan-2-yl)ethyl]-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | [H]/N=C1\CCCCC(CCNC2=NCCCC2)N1 |
| InChI | InChI=1S/C13H24N4/c14-12-6-2-1-5-11(17-12)8-10-16-13-7-3-4-9-15-13/h11H,1-10H2,(H2,14,17)(H,15,16) |
| InChIKey | KGIQBMXZCZIYCS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|