C11H21IN2 — CID 18428450
N-cyclohexyl-2,3,4,5-tetrahydropyridin-6-amine;hydroiodide (PubChem CID 18428450) has the molecular formula C11H21IN2 and a molecular weight of 308.21 g/mol. Its IUPAC name is N-cyclohexyl-2,3,4,5-tetrahydropyridin-6-amine;hydroiodide.
| Compound Name | N-cyclohexyl-2,3,4,5-tetrahydropyridin-6-amine;hydroiodide |
|---|---|
| PubChem CID | 18428450 |
| Molecular Formula | C11H21IN2 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | N-cyclohexyl-2,3,4,5-tetrahydropyridin-6-amine;hydroiodide |
| SMILES | C1CCC(NC2=NCCCC2)CC1.I |
| InChI | InChI=1S/C11H20N2.HI/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11;/h10H,1-9H2,(H,12,13);1H |
| InChIKey | WUZWUDWFDPXNIU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|