About N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine
N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 7059324) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine.
Molecular Properties
| Compound Name | N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine |
| PubChem CID | 7059324 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | C1CN=C(NC2CCCC2)C1 |
| InChI | InChI=1S/C9H16N2/c1-2-5-8(4-1)11-9-6-3-7-10-9/h8H,1-7H2,(H,10,11) |
| InChIKey | WOMSKQIZMGUPDX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine?
The IUPAC name of N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine (CID 7059324) is N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine.
What is the SMILES notation for N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine?
The canonical SMILES for N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine is C1CN=C(NC2CCCC2)C1.
What is the InChIKey of N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine?
The InChIKey is WOMSKQIZMGUPDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-2-5-8(4-1)11-9-6-3-7-10-9/h8H,1-7H2,(H,10,11).
What are the key properties of N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine?
N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine has a molecular weight of 152.24 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine is sourced from PubChem (CID 7059324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).