C9H16N2 — CID 7059324
N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 7059324) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 7059324 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N-cyclopentyl-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | C1CN=C(NC2CCCC2)C1 |
| InChI | InChI=1S/C9H16N2/c1-2-5-8(4-1)11-9-6-3-7-10-9/h8H,1-7H2,(H,10,11) |
| InChIKey | WOMSKQIZMGUPDX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |