C12H22N2 — CID 81385779
N-[(1R)-1-cyclohexylethyl]-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 81385779) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is N-[(1R)-1-cyclohexylethyl]-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | N-[(1R)-1-cyclohexylethyl]-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 81385779 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N-[(1R)-1-cyclohexylethyl]-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | C[C@@H](NC1=NCCC1)C1CCCCC1 |
| InChI | InChI=1S/C12H22N2/c1-10(11-6-3-2-4-7-11)14-12-8-5-9-13-12/h10-11H,2-9H2,1H3,(H,13,14)/t10-/m1/s1 |
| InChIKey | IVTLERBBURLLOA-SNVBAGLBSA-N |
| XLogP | 2.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |