C12H23N3 — CID 104921054
N-[(1R)-1-cycloheptylethyl]-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 104921054) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is N-[(1R)-1-cycloheptylethyl]-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-[(1R)-1-cycloheptylethyl]-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 104921054 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | N-[(1R)-1-cycloheptylethyl]-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | C[C@@H](NC1=NCCN1)C1CCCCCC1 |
| InChI | InChI=1S/C12H23N3/c1-10(15-12-13-8-9-14-12)11-6-4-2-3-5-7-11/h10-11H,2-9H2,1H3,(H2,13,14,15)/t10-/m1/s1 |
| InChIKey | SJCDCTUHCJCWCR-SNVBAGLBSA-N |
| XLogP | 1.89 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |