C14H26N2O — CID 79503429
N-(2-cyclohexyloxyethyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 79503429) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is N-(2-cyclohexyloxyethyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | N-(2-cyclohexyloxyethyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 79503429 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | N-(2-cyclohexyloxyethyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | C1CCN=C(NCCOC2CCCCC2)CC1 |
| InChI | InChI=1S/C14H26N2O/c1-3-7-13(8-4-1)17-12-11-16-14-9-5-2-6-10-15-14/h13H,1-12H2,(H,15,16) |
| InChIKey | RVYKLCCPSVVZRM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|