C8H20ClN5 — CID 176517139
1-(diaminomethylidene)-3-(4-methylpentyl)guanidine;hydrochloride (PubChem CID 176517139) has the molecular formula C8H20ClN5 and a molecular weight of 221.74 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-(4-methylpentyl)guanidine;hydrochloride.
| Compound Name | 1-(diaminomethylidene)-3-(4-methylpentyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 176517139 |
| Molecular Formula | C8H20ClN5 |
| Molecular Weight | 221.74 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1-(diaminomethylidene)-3-(4-methylpentyl)guanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(/N=C(N)N)NCCCC(C)C |
| InChI | InChI=1S/C8H19N5.ClH/c1-6(2)4-3-5-12-8(11)13-7(9)10;/h6H,3-5H2,1-2H3,(H6,9,10,11,12,13);1H |
| InChIKey | PBYAZFCROWGGGH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.74 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|