C17H9BrFNO2 — CID 176520503
4-[(1E)-3-(3-bromo-2-hydroxyphenyl)-4-oxobuta-1,3-dienyl]-3-fluorobenzonitrile (PubChem CID 176520503) has the molecular formula C17H9BrFNO2 and a molecular weight of 358.17 g/mol. Its IUPAC name is 4-[(1E)-3-(3-bromo-2-hydroxyphenyl)-4-oxobuta-1,3-dienyl]-3-fluorobenzonitrile.
| Compound Name | 4-[(1E)-3-(3-bromo-2-hydroxyphenyl)-4-oxobuta-1,3-dienyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 176520503 |
| Molecular Formula | C17H9BrFNO2 |
| Molecular Weight | 358.17 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 4-[(1E)-3-(3-bromo-2-hydroxyphenyl)-4-oxobuta-1,3-dienyl]-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(/C=C/C(=C=O)c2cccc(Br)c2O)c(F)c1 |
| InChI | InChI=1S/C17H9BrFNO2/c18-15-3-1-2-14(17(15)22)13(10-21)7-6-12-5-4-11(9-20)8-16(12)19/h1-8,22H/b7-6+ |
| InChIKey | GRUMERJKRVYNJX-VOTSOKGWSA-N |
| XLogP | 4.09 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.17 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|