C11H8FNO — CID 21336692
3-fluoro-4-[(1E,3E)-4-hydroxybuta-1,3-dienyl]benzonitrile (PubChem CID 21336692) has the molecular formula C11H8FNO and a molecular weight of 189.19 g/mol. Its IUPAC name is 3-fluoro-4-[(1E,3E)-4-hydroxybuta-1,3-dienyl]benzonitrile.
| Compound Name | 3-fluoro-4-[(1E,3E)-4-hydroxybuta-1,3-dienyl]benzonitrile |
|---|---|
| PubChem CID | 21336692 |
| Molecular Formula | C11H8FNO |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 3-fluoro-4-[(1E,3E)-4-hydroxybuta-1,3-dienyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C/C=C/O)c(F)c1 |
| InChI | InChI=1S/C11H8FNO/c12-11-7-9(8-13)4-5-10(11)3-1-2-6-14/h1-7,14H/b3-1+,6-2+ |
| InChIKey | JMWFHPMVOOWFKO-DHWRHDBVSA-N |
| XLogP | 2.78 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|