C11H16N4 — CID 176523419
N-[N'-[1-deuterio-2-(3-deuteriophenyl)ethyl]carbamimidoyl]ethanimidamide (PubChem CID 176523419) has the molecular formula C11H16N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is N-[N'-[1-deuterio-2-(3-deuteriophenyl)ethyl]carbamimidoyl]ethanimidamide.
| Compound Name | N-[N'-[1-deuterio-2-(3-deuteriophenyl)ethyl]carbamimidoyl]ethanimidamide |
|---|---|
| PubChem CID | 176523419 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | N-[N'-[1-deuterio-2-(3-deuteriophenyl)ethyl]carbamimidoyl]ethanimidamide |
| SMILES | [H]/N=C(\C)N/C(N)=N/C([2H])Cc1cccc([2H])c1 |
| InChI | InChI=1S/C11H16N4/c1-9(12)15-11(13)14-8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H4,12,13,14,15)/i3D,8D |
| InChIKey | RHNOFMBNSFLJPW-IVMPHTLKSA-N |
| XLogP | 1.13 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|