C18H18N5Se — CID 176523583
CID 176523583 (PubChem CID 176523583) has the molecular formula C18H18N5Se and a molecular weight of 383.34 g/mol.
| Compound Name | CID 176523583 |
|---|---|
| PubChem CID | 176523583 |
| Molecular Formula | C18H18N5Se |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | — |
| SMILES | N#CC1=C([Se])N=C(N)C(=C=N)C12CCN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C18H18N5Se/c19-10-14-16(21)22-17(24)15(11-20)18(14)6-8-23(9-7-18)12-13-4-2-1-3-5-13/h1-5,19H,6-9,12H2,(H2,21,22) |
| InChIKey | QPJGSMASWQAHBT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|