C23H26F3N7O3 — CID 176525626
2-[1-(5-cyclopropylpyrimidin-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-N-[2-[[6-(oxomethylidene)-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]acetamide (PubChem CID 176525626) has the molecular formula C23H26F3N7O3 and a molecular weight of 505.50 g/mol. Its IUPAC name is 2-[1-(5-cyclopropylpyrimidin-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-N-[2-[[6-(oxomethylidene)-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]acetamide.
| Compound Name | 2-[1-(5-cyclopropylpyrimidin-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-N-[2-[[6-(oxomethylidene)-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]acetamide |
|---|---|
| PubChem CID | 176525626 |
| Molecular Formula | C23H26F3N7O3 |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 2-[1-(5-cyclopropylpyrimidin-2-yl)-3,6-dihydro-2H-pyridin-4-yl]-N-[2-[[6-(oxomethylidene)-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]propoxy]acetamide |
| SMILES | CC(CONC(=O)CC1=CCN(c2ncc(C3CC3)cn2)CC1)NC1=C(C(F)(F)F)C(=C=O)NN=C1 |
| InChI | InChI=1S/C23H26F3N7O3/c1-14(30-18-11-29-31-19(12-34)21(18)23(24,25)26)13-36-32-20(35)8-15-4-6-33(7-5-15)22-27-9-17(10-28-22)16-2-3-16/h4,9-11,14,16,30-31H,2-3,5-8,13H2,1H3,(H,32,35) |
| InChIKey | IOZUKLGLEZDSOV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|