C14H22FN5 — CID 176526735
N-[N'-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)carbamimidoyl]piperidine-1-carboximidamide (PubChem CID 176526735) has the molecular formula C14H22FN5 and a molecular weight of 279.36 g/mol. Its IUPAC name is N-[N'-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)carbamimidoyl]piperidine-1-carboximidamide.
| Compound Name | N-[N'-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)carbamimidoyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 176526735 |
| Molecular Formula | C14H22FN5 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | N-[N'-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)carbamimidoyl]piperidine-1-carboximidamide |
| SMILES | [H]/N=C(/N/C(N)=N/C1=CC=C(F)C(C)C1)N1CCCCC1 |
| InChI | InChI=1S/C14H22FN5/c1-10-9-11(5-6-12(10)15)18-13(16)19-14(17)20-7-3-2-4-8-20/h5-6,10H,2-4,7-9H2,1H3,(H4,16,17,18,19) |
| InChIKey | MMYZZWFECDEUCS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|