C14H23FN6 — CID 176530266
N-[amino-[(2-fluoro-6-methylcyclohexa-1,3-dien-1-yl)amino]methylidene]-4-methylpiperazine-1-carboximidamide (PubChem CID 176530266) has the molecular formula C14H23FN6 and a molecular weight of 294.38 g/mol. Its IUPAC name is N-[amino-[(2-fluoro-6-methylcyclohexa-1,3-dien-1-yl)amino]methylidene]-4-methylpiperazine-1-carboximidamide.
| Compound Name | N-[amino-[(2-fluoro-6-methylcyclohexa-1,3-dien-1-yl)amino]methylidene]-4-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 176530266 |
| Molecular Formula | C14H23FN6 |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | N-[amino-[(2-fluoro-6-methylcyclohexa-1,3-dien-1-yl)amino]methylidene]-4-methylpiperazine-1-carboximidamide |
| SMILES | [H]/N=C(/N=C(N)NC1=C(F)C=CCC1C)N1CCN(C)CC1 |
| InChI | InChI=1S/C14H23FN6/c1-10-4-3-5-11(15)12(10)18-13(16)19-14(17)21-8-6-20(2)7-9-21/h3,5,10H,4,6-9H2,1-2H3,(H4,16,17,18,19) |
| InChIKey | GUTIQDKELJYSIH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|