C15H24N4 — CID 172616648
6-methylidene-5-[(Z)-3-methylpent-1-enyl]-4-piperazin-1-yl-1H-pyrimidine (PubChem CID 172616648) has the molecular formula C15H24N4 and a molecular weight of 260.39 g/mol. Its IUPAC name is 6-methylidene-5-[(Z)-3-methylpent-1-enyl]-4-piperazin-1-yl-1H-pyrimidine.
| Compound Name | 6-methylidene-5-[(Z)-3-methylpent-1-enyl]-4-piperazin-1-yl-1H-pyrimidine |
|---|---|
| PubChem CID | 172616648 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.39 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 6-methylidene-5-[(Z)-3-methylpent-1-enyl]-4-piperazin-1-yl-1H-pyrimidine |
| SMILES | C=C1NC=NC(N2CCNCC2)=C1/C=C\C(C)CC |
| InChI | InChI=1S/C15H24N4/c1-4-12(2)5-6-14-13(3)17-11-18-15(14)19-9-7-16-8-10-19/h5-6,11-12,16H,3-4,7-10H2,1-2H3,(H,17,18)/b6-5- |
| InChIKey | UFGBWEBGWDJWFE-WAYWQWQTSA-N |
| XLogP | 1.85 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |