C21H36N4 — CID 143604854
ethane;N-[(1E,3Z,5Z,7E)-8-ethylcycloocta-1,3,5,7-tetraen-1-yl]-N'-methyl-2-propan-2-ylpiperazine-1-carboximidamide (PubChem CID 143604854) has the molecular formula C21H36N4 and a molecular weight of 344.55 g/mol. Its IUPAC name is ethane;N-[(1E,3Z,5Z,7E)-8-ethylcycloocta-1,3,5,7-tetraen-1-yl]-N'-methyl-2-propan-2-ylpiperazine-1-carboximidamide.
| Compound Name | ethane;N-[(1E,3Z,5Z,7E)-8-ethylcycloocta-1,3,5,7-tetraen-1-yl]-N'-methyl-2-propan-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 143604854 |
| Molecular Formula | C21H36N4 |
| Molecular Weight | 344.55 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | ethane;N-[(1E,3Z,5Z,7E)-8-ethylcycloocta-1,3,5,7-tetraen-1-yl]-N'-methyl-2-propan-2-ylpiperazine-1-carboximidamide |
| SMILES | CC.CCC1=C/C=C\C=C/C=C\1N/C(=N/C)N1CCNCC1C(C)C |
| InChI | InChI=1S/C19H30N4.C2H6/c1-5-16-10-8-6-7-9-11-17(16)22-19(20-4)23-13-12-21-14-18(23)15(2)3;1-2/h6-11,15,18,21H,5,12-14H2,1-4H3,(H,20,22);1-2H3/b7-6-,8-6-,9-7-,10-8-,11-9-,16-10-,17-11+,17-16+; |
| InChIKey | PVHHTRAJNPCTBE-XNFVFUKQSA-N |
| XLogP | 3.86 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|