C19H32N6 — CID 88907781
methyl-[4-methyl-5-[(2E,4Z,6R)-6-methylocta-2,4-dien-2-yl]-2-piperazin-1-yl-4H-pyrimidin-3-yl]diazene (PubChem CID 88907781) has the molecular formula C19H32N6 and a molecular weight of 344.51 g/mol. Its IUPAC name is methyl-[4-methyl-5-[(2E,4Z,6R)-6-methylocta-2,4-dien-2-yl]-2-piperazin-1-yl-4H-pyrimidin-3-yl]diazene.
| Compound Name | methyl-[4-methyl-5-[(2E,4Z,6R)-6-methylocta-2,4-dien-2-yl]-2-piperazin-1-yl-4H-pyrimidin-3-yl]diazene |
|---|---|
| PubChem CID | 88907781 |
| Molecular Formula | C19H32N6 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | methyl-[4-methyl-5-[(2E,4Z,6R)-6-methylocta-2,4-dien-2-yl]-2-piperazin-1-yl-4H-pyrimidin-3-yl]diazene |
| SMILES | CC[C@@H](C)/C=C\C=C(/C)C1=CN=C(N2CCNCC2)N(/N=N/C)C1C |
| InChI | InChI=1S/C19H32N6/c1-6-15(2)8-7-9-16(3)18-14-22-19(24-12-10-21-11-13-24)25(17(18)4)23-20-5/h7-9,14-15,17,21H,6,10-13H2,1-5H3/b8-7-,16-9+,23-20+/t15-,17?/m1/s1 |
| InChIKey | IFCQUOXOJJICKW-LLUCQKJLSA-N |
| XLogP | 3.38 |
| TPSA | 55.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|