C18H33NO — CID 176527482
2-aminooctadeca-1,3,4-trien-1-ol (PubChem CID 176527482) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is 2-aminooctadeca-1,3,4-trien-1-ol.
| Compound Name | 2-aminooctadeca-1,3,4-trien-1-ol |
|---|---|
| PubChem CID | 176527482 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 2-aminooctadeca-1,3,4-trien-1-ol |
| SMILES | CCCCCCCCCCCCCC=C=CC(N)=CO |
| InChI | InChI=1S/C18H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18(19)17-20/h14,16-17,20H,2-13,19H2,1H3 |
| InChIKey | GKILNIBLZVARHM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|