C11H11N3O2 — CID 176531031
carbon dioxide;4-[(4-methylphenyl)methyl]-2H-triazole (PubChem CID 176531031) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is carbon dioxide;4-[(4-methylphenyl)methyl]-2H-triazole.
| Compound Name | carbon dioxide;4-[(4-methylphenyl)methyl]-2H-triazole |
|---|---|
| PubChem CID | 176531031 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | carbon dioxide;4-[(4-methylphenyl)methyl]-2H-triazole |
| SMILES | Cc1ccc(Cc2cn[nH]n2)cc1.O=C=O |
| InChI | InChI=1S/C10H11N3.CO2/c1-8-2-4-9(5-3-8)6-10-7-11-13-12-10;2-1-3/h2-5,7H,6H2,1H3,(H,11,12,13); |
| InChIKey | FDYKGQSNVHUIKN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |