C15H13N4O4S+ — CID 176533158
N-[(1R,2'S,3R,4R)-1-hydroxyspiro[2-oxa-1-azoniabicyclo[1.1.0]butane-4,5'-2H-1,3-thiazole]-2'-yl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 176533158) has the molecular formula C15H13N4O4S+ and a molecular weight of 345.36 g/mol. Its IUPAC name is N-[(1R,2'S,3R,4R)-1-hydroxyspiro[2-oxa-1-azoniabicyclo[1.1.0]butane-4,5'-2H-1,3-thiazole]-2'-yl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(1R,2'S,3R,4R)-1-hydroxyspiro[2-oxa-1-azoniabicyclo[1.1.0]butane-4,5'-2H-1,3-thiazole]-2'-yl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 176533158 |
| Molecular Formula | C15H13N4O4S+ |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-[(1R,2'S,3R,4R)-1-hydroxyspiro[2-oxa-1-azoniabicyclo[1.1.0]butane-4,5'-2H-1,3-thiazole]-2'-yl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)N[C@H]1N=C[C@@]2(S1)[C@H]1O[N@+]12O |
| InChI | InChI=1S/C15H12N4O4S/c1-8-10(11(18-22-8)9-5-3-2-4-6-9)12(20)17-14-16-7-15(24-14)13-19(15,21)23-13/h2-7,13-14,21H,1H3/p+1/t13-,14-,15-,19-/m1/s1 |
| InChIKey | CAKUGEFCTACLJD-DEXNDLTESA-O |
| XLogP | 1.67 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|