C6H10N4S — CID 176534301
6-methylsulfanyl-4,5,6,9-tetrahydro-1H-purine (PubChem CID 176534301) has the molecular formula C6H10N4S and a molecular weight of 170.24 g/mol. Its IUPAC name is 6-methylsulfanyl-4,5,6,9-tetrahydro-1H-purine.
| Compound Name | 6-methylsulfanyl-4,5,6,9-tetrahydro-1H-purine |
|---|---|
| PubChem CID | 176534301 |
| Molecular Formula | C6H10N4S |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 6-methylsulfanyl-4,5,6,9-tetrahydro-1H-purine |
| SMILES | CSC1NC=NC2NC=NC21 |
| InChI | InChI=1S/C6H10N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-6H,1H3,(H,7,8)(H,9,10) |
| InChIKey | NTGKGDAHQPFBJT-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |