C13H23N5 — CID 176535305
N-[N'-[(Z)-hex-3-enyl]carbamimidoyl]-3,6-dihydro-2H-pyridine-1-carboximidamide (PubChem CID 176535305) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is N-[N'-[(Z)-hex-3-enyl]carbamimidoyl]-3,6-dihydro-2H-pyridine-1-carboximidamide.
| Compound Name | N-[N'-[(Z)-hex-3-enyl]carbamimidoyl]-3,6-dihydro-2H-pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 176535305 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | N-[N'-[(Z)-hex-3-enyl]carbamimidoyl]-3,6-dihydro-2H-pyridine-1-carboximidamide |
| SMILES | [H]/N=C(\N/C(N)=N/CC/C=C\CC)N1CC=CCC1 |
| InChI | InChI=1S/C13H23N5/c1-2-3-4-6-9-16-12(14)17-13(15)18-10-7-5-8-11-18/h3-5,7H,2,6,8-11H2,1H3,(H4,14,15,16,17)/b4-3- |
| InChIKey | FZDLBDLMOHJKTK-ARJAWSKDSA-N |
| XLogP | 1.44 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|