C14H12F3NO — CID 176536815
N-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]buta-2,3-dienamide (PubChem CID 176536815) has the molecular formula C14H12F3NO and a molecular weight of 267.25 g/mol. Its IUPAC name is N-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]buta-2,3-dienamide.
| Compound Name | N-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]buta-2,3-dienamide |
|---|---|
| PubChem CID | 176536815 |
| Molecular Formula | C14H12F3NO |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]buta-2,3-dienamide |
| SMILES | C=C=CC(=O)NC1(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C14H12F3NO/c1-2-3-12(19)18-13(8-9-13)10-4-6-11(7-5-10)14(15,16)17/h3-7H,1,8-9H2,(H,18,19) |
| InChIKey | FJXZDQOAIZOFKN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|