About 2-(ethyliminomethyl)-N'-[(Z)-3-imino-2-methylprop-1-enyl]but-1-ene-1,4-diamine
2-(ethyliminomethyl)-N'-[(Z)-3-imino-2-methylprop-1-enyl]but-1-ene-1,4-diamine (PubChem CID 176537501) has the molecular formula C11H20N4
and a molecular weight of 208.31 g/mol. Its IUPAC name is 2-(ethyliminomethyl)-N'-[(Z)-3-imino-2-methylprop-1-enyl]but-1-ene-1,4-diamine.
Molecular Properties
| Compound Name | 2-(ethyliminomethyl)-N'-[(Z)-3-imino-2-methylprop-1-enyl]but-1-ene-1,4-diamine |
| PubChem CID | 176537501 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 2-(ethyliminomethyl)-N'-[(Z)-3-imino-2-methylprop-1-enyl]but-1-ene-1,4-diamine |
| SMILES | [H]/N=C/C(C)=C\NCCC(=CN)/C=N/CC |
| InChI | InChI=1S/C11H20N4/c1-3-14-9-11(7-13)4-5-15-8-10(2)6-12/h6-9,12,15H,3-5,13H2,1-2H3/b10-8-,11-7?,12-6+,14-9+ |
| InChIKey | IMBPONWOSPGFFK-POMKJIQCSA-N |
| XLogP | 1.45 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(ethyliminomethyl)-N'-[(Z)-3-imino-2-methylprop-1-enyl]but-1-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethyliminomethyl)-N'-[(Z)-3-imino-2-methylprop-1-enyl]but-1-ene-1,4-diamine?
The IUPAC name of 2-(ethyliminomethyl)-N'-[(Z)-3-imino-2-methylprop-1-enyl]but-1-ene-1,4-diamine (CID 176537501) is 2-(ethyliminomethyl)-N'-[(Z)-3-imino-2-methylprop-1-enyl]but-1-ene-1,4-diamine.
What is the SMILES notation for 2-(ethyliminomethyl)-N'-[(Z)-3-imino-2-methylprop-1-enyl]but-1-ene-1,4-diamine?
The canonical SMILES for 2-(ethyliminomethyl)-N'-[(Z)-3-imino-2-methylprop-1-enyl]but-1-ene-1,4-diamine is [H]/N=C/C(C)=C\NCCC(=CN)/C=N/CC.
What is the InChIKey of 2-(ethyliminomethyl)-N'-[(Z)-3-imino-2-methylprop-1-enyl]but-1-ene-1,4-diamine?
The InChIKey is IMBPONWOSPGFFK-POMKJIQCSA-N. The full InChI is InChI=1S/C11H20N4/c1-3-14-9-11(7-13)4-5-15-8-10(2)6-12/h6-9,12,15H,3-5,13H2,1-2H3/b10-8-,11-7?,12-6+,14-9+.
What are the key properties of 2-(ethyliminomethyl)-N'-[(Z)-3-imino-2-methylprop-1-enyl]but-1-ene-1,4-diamine?
2-(ethyliminomethyl)-N'-[(Z)-3-imino-2-methylprop-1-enyl]but-1-ene-1,4-diamine has a molecular weight of 208.31 g/mol, XLogP of 1.45, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethyliminomethyl)-N'-[(Z)-3-imino-2-methylprop-1-enyl]but-1-ene-1,4-diamine is sourced from PubChem (CID 176537501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).