C24H36IN5O — CID 176544595
N-[5-[4-iodobutyl(methyl)amino]-1H-pyrido[2,3-c]pyridazin-6-yl]cycloundecanecarboxamide (PubChem CID 176544595) has the molecular formula C24H36IN5O and a molecular weight of 537.49 g/mol. Its IUPAC name is N-[5-[4-iodobutyl(methyl)amino]-1H-pyrido[2,3-c]pyridazin-6-yl]cycloundecanecarboxamide.
| Compound Name | N-[5-[4-iodobutyl(methyl)amino]-1H-pyrido[2,3-c]pyridazin-6-yl]cycloundecanecarboxamide |
|---|---|
| PubChem CID | 176544595 |
| Molecular Formula | C24H36IN5O |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | N-[5-[4-iodobutyl(methyl)amino]-1H-pyrido[2,3-c]pyridazin-6-yl]cycloundecanecarboxamide |
| SMILES | CN(CCCCI)c1c(NC(=O)C2CCCCCCCCCC2)cnc2c1C=C=NN2 |
| InChI | InChI=1S/C24H36IN5O/c1-30(17-11-10-15-25)22-20-14-16-27-29-23(20)26-18-21(22)28-24(31)19-12-8-6-4-2-3-5-7-9-13-19/h14,18-19H,2-13,15,17H2,1H3,(H,26,29)(H,28,31) |
| InChIKey | OMUUZOOOEIMXGH-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|