C22H32IN3OS — CID 129310472
N-[7-[4-iodobutyl(methyl)amino]thieno[3,2-b]pyridin-6-yl]cyclononanecarboxamide (PubChem CID 129310472) has the molecular formula C22H32IN3OS and a molecular weight of 513.49 g/mol. Its IUPAC name is N-[7-[4-iodobutyl(methyl)amino]thieno[3,2-b]pyridin-6-yl]cyclononanecarboxamide.
| Compound Name | N-[7-[4-iodobutyl(methyl)amino]thieno[3,2-b]pyridin-6-yl]cyclononanecarboxamide |
|---|---|
| PubChem CID | 129310472 |
| Molecular Formula | C22H32IN3OS |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | N-[7-[4-iodobutyl(methyl)amino]thieno[3,2-b]pyridin-6-yl]cyclononanecarboxamide |
| SMILES | CN(CCCCI)c1c(NC(=O)C2CCCCCCCC2)cnc2ccsc12 |
| InChI | InChI=1S/C22H32IN3OS/c1-26(14-9-8-13-23)20-19(16-24-18-12-15-28-21(18)20)25-22(27)17-10-6-4-2-3-5-7-11-17/h12,15-17H,2-11,13-14H2,1H3,(H,25,27) |
| InChIKey | LHGHMNZLCXCONU-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|