carbon dioxide;4-(3-phenylphenoxy)-2H-triazole

C15H11N3O3 — CID 176545249

IUPACcarbon dioxide;4-(3-phenylphenoxy)-2H-triazole
SMILESO=C=O.c1ccc(-c2cccc(Oc3cn[nH]n3)c2)cc1
InChIInChI=1S/C14H11N3O.CO2/c1-2-5-11(6-3-1)12-7-4-8-13(9-12)18-14-10-15-17-16-14;2-1-3/h1-10H,(H,15,16,17);
InChIKeyIIWIHNFDLBNFMU-UHFFFAOYSA-N
MW281.27 g/mol
LogP2.68
Rot. Bonds3

About carbon dioxide;4-(3-phenylphenoxy)-2H-triazole

carbon dioxide;4-(3-phenylphenoxy)-2H-triazole (PubChem CID 176545249) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is carbon dioxide;4-(3-phenylphenoxy)-2H-triazole.

Molecular Properties

Compound Namecarbon dioxide;4-(3-phenylphenoxy)-2H-triazole
PubChem CID176545249
Molecular FormulaC15H11N3O3
Molecular Weight281.27 g/mol
Exact Mass281.08
IUPAC Namecarbon dioxide;4-(3-phenylphenoxy)-2H-triazole
SMILESO=C=O.c1ccc(-c2cccc(Oc3cn[nH]n3)c2)cc1
InChIInChI=1S/C14H11N3O.CO2/c1-2-5-11(6-3-1)12-7-4-8-13(9-12)18-14-10-15-17-16-14;2-1-3/h1-10H,(H,15,16,17);
InChIKeyIIWIHNFDLBNFMU-UHFFFAOYSA-N
XLogP2.68
TPSA84.94 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.27
LogP ≤ 52.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze carbon dioxide;4-(3-phenylphenoxy)-2H-triazole with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;4-(3-phenylphenoxy)-2H-triazole?
The IUPAC name of carbon dioxide;4-(3-phenylphenoxy)-2H-triazole (CID 176545249) is carbon dioxide;4-(3-phenylphenoxy)-2H-triazole.
What is the SMILES notation for carbon dioxide;4-(3-phenylphenoxy)-2H-triazole?
The canonical SMILES for carbon dioxide;4-(3-phenylphenoxy)-2H-triazole is O=C=O.c1ccc(-c2cccc(Oc3cn[nH]n3)c2)cc1.
What is the InChIKey of carbon dioxide;4-(3-phenylphenoxy)-2H-triazole?
The InChIKey is IIWIHNFDLBNFMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O.CO2/c1-2-5-11(6-3-1)12-7-4-8-13(9-12)18-14-10-15-17-16-14;2-1-3/h1-10H,(H,15,16,17);.
What are the key properties of carbon dioxide;4-(3-phenylphenoxy)-2H-triazole?
carbon dioxide;4-(3-phenylphenoxy)-2H-triazole has a molecular weight of 281.27 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;4-(3-phenylphenoxy)-2H-triazole is sourced from PubChem (CID 176545249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).