carbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole

C19H13N3O3 — CID 176530149

IUPACcarbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole
SMILESO=C=O.c1ccc2cc(-c3ccc(Oc4cn[nH]n4)cc3)ccc2c1
InChIInChI=1S/C18H13N3O.CO2/c1-2-4-15-11-16(6-5-13(15)3-1)14-7-9-17(10-8-14)22-18-12-19-21-20-18;2-1-3/h1-12H,(H,19,20,21);
InChIKeyMENOTVBDZRLBHF-UHFFFAOYSA-N
MW331.33 g/mol
LogP3.83
Rot. Bonds3

About carbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole

carbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole (PubChem CID 176530149) has the molecular formula C19H13N3O3 and a molecular weight of 331.33 g/mol. Its IUPAC name is carbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole.

Molecular Properties

Compound Namecarbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole
PubChem CID176530149
Molecular FormulaC19H13N3O3
Molecular Weight331.33 g/mol
Exact Mass331.10
IUPAC Namecarbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole
SMILESO=C=O.c1ccc2cc(-c3ccc(Oc4cn[nH]n4)cc3)ccc2c1
InChIInChI=1S/C18H13N3O.CO2/c1-2-4-15-11-16(6-5-13(15)3-1)14-7-9-17(10-8-14)22-18-12-19-21-20-18;2-1-3/h1-12H,(H,19,20,21);
InChIKeyMENOTVBDZRLBHF-UHFFFAOYSA-N
XLogP3.83
TPSA84.94 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500331.33
LogP ≤ 53.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze carbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole?
The IUPAC name of carbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole (CID 176530149) is carbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole.
What is the SMILES notation for carbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole?
The canonical SMILES for carbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole is O=C=O.c1ccc2cc(-c3ccc(Oc4cn[nH]n4)cc3)ccc2c1.
What is the InChIKey of carbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole?
The InChIKey is MENOTVBDZRLBHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O.CO2/c1-2-4-15-11-16(6-5-13(15)3-1)14-7-9-17(10-8-14)22-18-12-19-21-20-18;2-1-3/h1-12H,(H,19,20,21);.
What are the key properties of carbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole?
carbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole has a molecular weight of 331.33 g/mol, XLogP of 3.83, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;4-(4-naphthalen-2-ylphenoxy)-2H-triazole is sourced from PubChem (CID 176530149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).