C17H14N4O4 — CID 176545527
carbon dioxide;N-[4-[4-(2H-triazol-4-yloxy)phenyl]phenyl]acetamide (PubChem CID 176545527) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is carbon dioxide;N-[4-[4-(2H-triazol-4-yloxy)phenyl]phenyl]acetamide.
| Compound Name | carbon dioxide;N-[4-[4-(2H-triazol-4-yloxy)phenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 176545527 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | carbon dioxide;N-[4-[4-(2H-triazol-4-yloxy)phenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2ccc(Oc3cn[nH]n3)cc2)cc1.O=C=O |
| InChI | InChI=1S/C16H14N4O2.CO2/c1-11(21)18-14-6-2-12(3-7-14)13-4-8-15(9-5-13)22-16-10-17-20-19-16;2-1-3/h2-10H,1H3,(H,18,21)(H,17,19,20); |
| InChIKey | KAKMOZFRNBJKAI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |