C12H14FN — CID 176546647
1-(4-fluorophenyl)-N-propylpropa-1,2-dien-1-amine (PubChem CID 176546647) has the molecular formula C12H14FN and a molecular weight of 191.25 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-propylpropa-1,2-dien-1-amine.
| Compound Name | 1-(4-fluorophenyl)-N-propylpropa-1,2-dien-1-amine |
|---|---|
| PubChem CID | 176546647 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 1-(4-fluorophenyl)-N-propylpropa-1,2-dien-1-amine |
| SMILES | C=C=C(NCCC)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H14FN/c1-3-9-14-12(4-2)10-5-7-11(13)8-6-10/h5-8,14H,2-3,9H2,1H3 |
| InChIKey | VRCWPLGUHKPLJF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |