C12H26N6 — CID 176546913
1-carbamimidoyl-2-[[1-(dimethylamino)-3-methylcyclohexyl]methyl]guanidine (PubChem CID 176546913) has the molecular formula C12H26N6 and a molecular weight of 254.38 g/mol. Its IUPAC name is 1-carbamimidoyl-2-[[1-(dimethylamino)-3-methylcyclohexyl]methyl]guanidine.
| Compound Name | 1-carbamimidoyl-2-[[1-(dimethylamino)-3-methylcyclohexyl]methyl]guanidine |
|---|---|
| PubChem CID | 176546913 |
| Molecular Formula | C12H26N6 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 1-carbamimidoyl-2-[[1-(dimethylamino)-3-methylcyclohexyl]methyl]guanidine |
| SMILES | [H]/N=C(\N)N/C(N)=N/CC1(N(C)C)CCCC(C)C1 |
| InChI | InChI=1S/C12H26N6/c1-9-5-4-6-12(7-9,18(2)3)8-16-11(15)17-10(13)14/h9H,4-8H2,1-3H3,(H6,13,14,15,16,17) |
| InChIKey | JCJMJUJOGKOQNV-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|