C19H29NO4 — CID 176548576
(3R,3aR,4aR,5R,8aR,9aR)-8a-methyl-3-(morpholin-4-ylmethyl)spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one (PubChem CID 176548576) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is (3R,3aR,4aR,5R,8aR,9aR)-8a-methyl-3-(morpholin-4-ylmethyl)spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one.
| Compound Name | (3R,3aR,4aR,5R,8aR,9aR)-8a-methyl-3-(morpholin-4-ylmethyl)spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 176548576 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | (3R,3aR,4aR,5R,8aR,9aR)-8a-methyl-3-(morpholin-4-ylmethyl)spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
| SMILES | C[C@]12CCC[C@]3(CO3)[C@@H]1C[C@@H]1[C@H](CN3CCOCC3)C(=O)O[C@@H]1C2 |
| InChI | InChI=1S/C19H29NO4/c1-18-3-2-4-19(12-23-19)16(18)9-13-14(17(21)24-15(13)10-18)11-20-5-7-22-8-6-20/h13-16H,2-12H2,1H3/t13-,14+,15-,16-,18-,19+/m1/s1 |
| InChIKey | KNKBZPCJEWBZMS-GJWPJNNNSA-N |
| XLogP | 1.85 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|