C28H22CoN2O8 — CID 176549318
bis(6-(3-carboxy-4-methylphenyl)pyridine-3-carboxylic acid);cobalt (PubChem CID 176549318) has the molecular formula C28H22CoN2O8 and a molecular weight of 573.42 g/mol. Its IUPAC name is bis(6-(3-carboxy-4-methylphenyl)pyridine-3-carboxylic acid);cobalt.
| Compound Name | bis(6-(3-carboxy-4-methylphenyl)pyridine-3-carboxylic acid);cobalt |
|---|---|
| PubChem CID | 176549318 |
| Molecular Formula | C28H22CoN2O8 |
| Molecular Weight | 573.42 g/mol |
| Exact Mass | 573.07 |
| IUPAC Name | bis(6-(3-carboxy-4-methylphenyl)pyridine-3-carboxylic acid);cobalt |
| SMILES | Cc1ccc(-c2ccc(C(=O)O)cn2)cc1C(=O)O.Cc1ccc(-c2ccc(C(=O)O)cn2)cc1C(=O)O.[Co] |
| InChI | InChI=1S/2C14H11NO4.Co/c2*1-8-2-3-9(6-11(8)14(18)19)12-5-4-10(7-15-12)13(16)17;/h2*2-7H,1H3,(H,16,17)(H,18,19); |
| InChIKey | GSMQGOVNOKSXJC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 174.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |