C16H26N4O6 — CID 176549581
2,5-bis(2-methoxypropoxy)benzene-1,4-dicarbohydrazide (PubChem CID 176549581) has the molecular formula C16H26N4O6 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2,5-bis(2-methoxypropoxy)benzene-1,4-dicarbohydrazide.
| Compound Name | 2,5-bis(2-methoxypropoxy)benzene-1,4-dicarbohydrazide |
|---|---|
| PubChem CID | 176549581 |
| Molecular Formula | C16H26N4O6 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2,5-bis(2-methoxypropoxy)benzene-1,4-dicarbohydrazide |
| SMILES | COC(C)COc1cc(C(=O)NN)c(OCC(C)OC)cc1C(=O)NN |
| InChI | InChI=1S/C16H26N4O6/c1-9(23-3)7-25-13-5-12(16(22)20-18)14(26-8-10(2)24-4)6-11(13)15(21)19-17/h5-6,9-10H,7-8,17-18H2,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | NJSYOPXZJGOGSB-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|