C17H30N4O4 — CID 155712909
2,5-dipropoxybenzene-1,4-dicarbohydrazide;propane (PubChem CID 155712909) has the molecular formula C17H30N4O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2,5-dipropoxybenzene-1,4-dicarbohydrazide;propane.
| Compound Name | 2,5-dipropoxybenzene-1,4-dicarbohydrazide;propane |
|---|---|
| PubChem CID | 155712909 |
| Molecular Formula | C17H30N4O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 2,5-dipropoxybenzene-1,4-dicarbohydrazide;propane |
| SMILES | CCC.CCCOc1cc(C(=O)NN)c(OCCC)cc1C(=O)NN |
| InChI | InChI=1S/C14H22N4O4.C3H8/c1-3-5-21-11-7-10(14(20)18-16)12(22-6-4-2)8-9(11)13(19)17-15;1-3-2/h7-8H,3-6,15-16H2,1-2H3,(H,17,19)(H,18,20);3H2,1-2H3 |
| InChIKey | PHIPHJKIJWLSSW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|